C35H52IN9O12 — CID 86711731
ditert-butyl 2-[[6-[[2-[5-[(2,4-dinitroanilino)methyl]-4-iodotriazol-1-yl]acetyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate (PubChem CID 86711731) has the molecular formula C35H52IN9O12 and a molecular weight of 917.76 g/mol. Its IUPAC name is ditert-butyl 2-[[6-[[2-[5-[(2,4-dinitroanilino)methyl]-4-iodotriazol-1-yl]acetyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl 2-[[6-[[2-[5-[(2,4-dinitroanilino)methyl]-4-iodotriazol-1-yl]acetyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 86711731 |
| Molecular Formula | C35H52IN9O12 |
| Molecular Weight | 917.76 g/mol |
| Exact Mass | 917.28 |
| IUPAC Name | ditert-butyl 2-[[6-[[2-[5-[(2,4-dinitroanilino)methyl]-4-iodotriazol-1-yl]acetyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(NC(=O)NC(CCCCNC(=O)Cn1nnc(I)c1CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H52IN9O12/c1-33(2,3)55-28(47)16-15-24(31(49)57-35(7,8)9)40-32(50)39-23(30(48)56-34(4,5)6)12-10-11-17-37-27(46)20-43-26(29(36)41-42-43)19-38-22-14-13-21(44(51)52)18-25(22)45(53)54/h13-14,18,23-24,38H,10-12,15-17,19-20H2,1-9H3,(H,37,46)(H2,39,40,50) |
| InChIKey | MRIVEBKZYONKNU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 278.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.76 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|