C26H48N6O5 — CID 118966081
ditert-butyl (2S)-2-[[(3S)-7-[4-(aminomethyl)triazol-1-yl]-2,2-dimethylheptan-3-yl]carbamoylamino]pentanedioate (PubChem CID 118966081) has the molecular formula C26H48N6O5 and a molecular weight of 524.71 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(3S)-7-[4-(aminomethyl)triazol-1-yl]-2,2-dimethylheptan-3-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(3S)-7-[4-(aminomethyl)triazol-1-yl]-2,2-dimethylheptan-3-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 118966081 |
| Molecular Formula | C26H48N6O5 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | ditert-butyl (2S)-2-[[(3S)-7-[4-(aminomethyl)triazol-1-yl]-2,2-dimethylheptan-3-yl]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)N[C@@H](CCCCn1cc(CN)nn1)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H48N6O5/c1-24(2,3)20(12-10-11-15-32-17-18(16-27)30-31-32)29-23(35)28-19(22(34)37-26(7,8)9)13-14-21(33)36-25(4,5)6/h17,19-20H,10-16,27H2,1-9H3,(H2,28,29,35)/t19-,20-/m0/s1 |
| InChIKey | CCZPNNPIKDEHFB-PMACEKPBSA-N |
| XLogP | 3.45 |
| TPSA | 150.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|