C32H59N3O8 — CID 157119983
ditert-butyl (2S)-2-[[(3S)-2,2-dimethyl-7-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-propanoylamino]heptan-3-yl]carbamoylamino]pentanedioate (PubChem CID 157119983) has the molecular formula C32H59N3O8 and a molecular weight of 613.84 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(3S)-2,2-dimethyl-7-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-propanoylamino]heptan-3-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(3S)-2,2-dimethyl-7-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-propanoylamino]heptan-3-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 157119983 |
| Molecular Formula | C32H59N3O8 |
| Molecular Weight | 613.84 g/mol |
| Exact Mass | 613.43 |
| IUPAC Name | ditert-butyl (2S)-2-[[(3S)-2,2-dimethyl-7-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-propanoylamino]heptan-3-yl]carbamoylamino]pentanedioate |
| SMILES | CCC(=O)N(CCCC[C@H](NC(=O)N[C@@H](CCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(C)(C)C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H59N3O8/c1-14-24(36)35(21-26(38)42-31(8,9)10)20-16-15-17-23(29(2,3)4)34-28(40)33-22(27(39)43-32(11,12)13)18-19-25(37)41-30(5,6)7/h22-23H,14-21H2,1-13H3,(H2,33,34,40)/t22-,23-/m0/s1 |
| InChIKey | ZXAAEYOXQTWCRE-GOTSBHOMSA-N |
| XLogP | 5.28 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.84 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|