About cyclopentanamine;hexan-3-amine
cyclopentanamine;hexan-3-amine (PubChem CID 143368714) has the molecular formula C11H26N2
and a molecular weight of 186.34 g/mol. Its IUPAC name is cyclopentanamine;hexan-3-amine.
Molecular Properties
| Compound Name | cyclopentanamine;hexan-3-amine |
| PubChem CID | 143368714 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | cyclopentanamine;hexan-3-amine |
| SMILES | CCCC(N)CC.NC1CCCC1 |
| InChI | InChI=1S/C6H15N.C5H11N/c1-3-5-6(7)4-2;6-5-3-1-2-4-5/h6H,3-5,7H2,1-2H3;5H,1-4,6H2 |
| InChIKey | HODKKOUADSUZLK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopentanamine;hexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanamine;hexan-3-amine?
The IUPAC name of cyclopentanamine;hexan-3-amine (CID 143368714) is cyclopentanamine;hexan-3-amine.
What is the SMILES notation for cyclopentanamine;hexan-3-amine?
The canonical SMILES for cyclopentanamine;hexan-3-amine is CCCC(N)CC.NC1CCCC1.
What is the InChIKey of cyclopentanamine;hexan-3-amine?
The InChIKey is HODKKOUADSUZLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C5H11N/c1-3-5-6(7)4-2;6-5-3-1-2-4-5/h6H,3-5,7H2,1-2H3;5H,1-4,6H2.
What are the key properties of cyclopentanamine;hexan-3-amine?
cyclopentanamine;hexan-3-amine has a molecular weight of 186.34 g/mol, XLogP of 2.41, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanamine;hexan-3-amine is sourced from PubChem (CID 143368714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).