C5H14N2S — CID 175679057
(2S)-2,5-diaminopentane-1-thiol (PubChem CID 175679057) has the molecular formula C5H14N2S and a molecular weight of 134.25 g/mol. Its IUPAC name is (2S)-2,5-diaminopentane-1-thiol.
| Compound Name | (2S)-2,5-diaminopentane-1-thiol |
|---|---|
| PubChem CID | 175679057 |
| Molecular Formula | C5H14N2S |
| Molecular Weight | 134.25 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | (2S)-2,5-diaminopentane-1-thiol |
| SMILES | NCCC[C@H](N)CS |
| InChI | InChI=1S/C5H14N2S/c6-3-1-2-5(7)4-8/h5,8H,1-4,6-7H2/t5-/m0/s1 |
| InChIKey | ZKIRSVRGIKLJFI-YFKPBYRVSA-N |
| XLogP | -0.02 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.25 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|