C21H45NO5 — CID 87593311
(2S,3S)-2-aminooctadecane-1,3-diol;2-hydroxypropanoic acid (PubChem CID 87593311) has the molecular formula C21H45NO5 and a molecular weight of 391.59 g/mol. Its IUPAC name is (2S,3S)-2-aminooctadecane-1,3-diol;2-hydroxypropanoic acid.
| Compound Name | (2S,3S)-2-aminooctadecane-1,3-diol;2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 87593311 |
| Molecular Formula | C21H45NO5 |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.33 |
| IUPAC Name | (2S,3S)-2-aminooctadecane-1,3-diol;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.CCCCCCCCCCCCCCC[C@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C18H39NO2.C3H6O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20;1-2(4)3(5)6/h17-18,20-21H,2-16,19H2,1H3;2,4H,1H3,(H,5,6)/t17-,18-;/m0./s1 |
| InChIKey | DECYBOGOYHEFJJ-APTPAJQOSA-N |
| XLogP | 3.60 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|