C25H45NO6 — CID 73034018
2-aminooctadecane-1,3,4-triol;2-hydroxybenzoic acid (PubChem CID 73034018) has the molecular formula C25H45NO6 and a molecular weight of 455.64 g/mol. Its IUPAC name is 2-aminooctadecane-1,3,4-triol;2-hydroxybenzoic acid.
| Compound Name | 2-aminooctadecane-1,3,4-triol;2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 73034018 |
| Molecular Formula | C25H45NO6 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.32 |
| IUPAC Name | 2-aminooctadecane-1,3,4-triol;2-hydroxybenzoic acid |
| SMILES | CCCCCCCCCCCCCCC(O)C(O)C(N)CO.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C18H39NO3.C7H6O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20;8-6-4-2-1-3-5(6)7(9)10/h16-18,20-22H,2-15,19H2,1H3;1-4,8H,(H,9,10) |
| InChIKey | NTMFVGXTEGZVRI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|