C15H32O5S — CID 22212789
(2R,3S,4S,5R)-6-nonylsulfanylhexane-1,2,3,4,5-pentol (PubChem CID 22212789) has the molecular formula C15H32O5S and a molecular weight of 324.48 g/mol. Its IUPAC name is (2R,3S,4S,5R)-6-nonylsulfanylhexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3S,4S,5R)-6-nonylsulfanylhexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 22212789 |
| Molecular Formula | C15H32O5S |
| Molecular Weight | 324.48 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (2R,3S,4S,5R)-6-nonylsulfanylhexane-1,2,3,4,5-pentol |
| SMILES | CCCCCCCCCSC[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H32O5S/c1-2-3-4-5-6-7-8-9-21-11-13(18)15(20)14(19)12(17)10-16/h12-20H,2-11H2,1H3/t12-,13+,14+,15-/m1/s1 |
| InChIKey | IJRXEXDYZUXIGM-CBBWQLFWSA-N |
| XLogP | 0.91 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.48 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|