C15H32O4S — CID 175685092
(2S,3R,4R)-5-decylsulfanylpentane-1,2,3,4-tetrol (PubChem CID 175685092) has the molecular formula C15H32O4S and a molecular weight of 308.48 g/mol. Its IUPAC name is (2S,3R,4R)-5-decylsulfanylpentane-1,2,3,4-tetrol.
| Compound Name | (2S,3R,4R)-5-decylsulfanylpentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 175685092 |
| Molecular Formula | C15H32O4S |
| Molecular Weight | 308.48 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (2S,3R,4R)-5-decylsulfanylpentane-1,2,3,4-tetrol |
| SMILES | CCCCCCCCCCSC[C@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C15H32O4S/c1-2-3-4-5-6-7-8-9-10-20-12-14(18)15(19)13(17)11-16/h13-19H,2-12H2,1H3/t13-,14-,15+/m0/s1 |
| InChIKey | HNRZVFWASHMFMR-SOUVJXGZSA-N |
| XLogP | 1.94 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|