C22H46O4S2 — CID 11123044
(2S,3S,4S,5S)-1,6-bis(octylsulfanyl)hexane-2,3,4,5-tetrol (PubChem CID 11123044) has the molecular formula C22H46O4S2 and a molecular weight of 438.74 g/mol. Its IUPAC name is (2S,3S,4S,5S)-1,6-bis(octylsulfanyl)hexane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4S,5S)-1,6-bis(octylsulfanyl)hexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 11123044 |
| Molecular Formula | C22H46O4S2 |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (2S,3S,4S,5S)-1,6-bis(octylsulfanyl)hexane-2,3,4,5-tetrol |
| SMILES | CCCCCCCCSC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CSCCCCCCCC |
| InChI | InChI=1S/C22H46O4S2/c1-3-5-7-9-11-13-15-27-17-19(23)21(25)22(26)20(24)18-28-16-14-12-10-8-6-4-2/h19-26H,3-18H2,1-2H3/t19-,20-,21-,22-/m1/s1 |
| InChIKey | QSMQTHNJAPNXJX-GXRSIYKFSA-N |
| XLogP | 4.62 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|