C14H30O5S — CID 131846529
(2R,3S,4S,5R)-6-octylsulfanylhexane-1,2,3,4,5-pentol (PubChem CID 131846529) has the molecular formula C14H30O5S and a molecular weight of 310.46 g/mol. Its IUPAC name is (2R,3S,4S,5R)-6-octylsulfanylhexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3S,4S,5R)-6-octylsulfanylhexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 131846529 |
| Molecular Formula | C14H30O5S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (2R,3S,4S,5R)-6-octylsulfanylhexane-1,2,3,4,5-pentol |
| SMILES | CCCCCCCCSC[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H30O5S/c1-2-3-4-5-6-7-8-20-10-12(17)14(19)13(18)11(16)9-15/h11-19H,2-10H2,1H3/t11-,12+,13+,14-/m1/s1 |
| InChIKey | XWTHIAAGGRZLIS-ZOBORPQBSA-N |
| XLogP | 0.52 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|