About 4-ethyl-5,7-dimethyl-8-propan-2-ylundecane
4-ethyl-5,7-dimethyl-8-propan-2-ylundecane (PubChem CID 91173355) has the molecular formula C18H38
and a molecular weight of 254.50 g/mol. Its IUPAC name is 4-ethyl-5,7-dimethyl-8-propan-2-ylundecane.
Molecular Properties
| Compound Name | 4-ethyl-5,7-dimethyl-8-propan-2-ylundecane |
| PubChem CID | 91173355 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | 4-ethyl-5,7-dimethyl-8-propan-2-ylundecane |
| SMILES | CCCC(CC)C(C)CC(C)C(CCC)C(C)C |
| InChI | InChI=1S/C18H38/c1-8-11-17(10-3)15(6)13-16(7)18(12-9-2)14(4)5/h14-18H,8-13H2,1-7H3 |
| InChIKey | VHMGTXZVVRTTSO-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-ethyl-5,7-dimethyl-8-propan-2-ylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5,7-dimethyl-8-propan-2-ylundecane?
The IUPAC name of 4-ethyl-5,7-dimethyl-8-propan-2-ylundecane (CID 91173355) is 4-ethyl-5,7-dimethyl-8-propan-2-ylundecane.
What is the SMILES notation for 4-ethyl-5,7-dimethyl-8-propan-2-ylundecane?
The canonical SMILES for 4-ethyl-5,7-dimethyl-8-propan-2-ylundecane is CCCC(CC)C(C)CC(C)C(CCC)C(C)C.
What is the InChIKey of 4-ethyl-5,7-dimethyl-8-propan-2-ylundecane?
The InChIKey is VHMGTXZVVRTTSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38/c1-8-11-17(10-3)15(6)13-16(7)18(12-9-2)14(4)5/h14-18H,8-13H2,1-7H3.
What are the key properties of 4-ethyl-5,7-dimethyl-8-propan-2-ylundecane?
4-ethyl-5,7-dimethyl-8-propan-2-ylundecane has a molecular weight of 254.50 g/mol, XLogP of 6.55, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5,7-dimethyl-8-propan-2-ylundecane is sourced from PubChem (CID 91173355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).