C17H36 — CID 123222302
4,5,7-triethylundecane (PubChem CID 123222302) has the molecular formula C17H36 and a molecular weight of 240.47 g/mol. Its IUPAC name is 4,5,7-triethylundecane.
| Compound Name | 4,5,7-triethylundecane |
|---|---|
| PubChem CID | 123222302 |
| Molecular Formula | C17H36 |
| Molecular Weight | 240.47 g/mol |
| Exact Mass | 240.28 |
| IUPAC Name | 4,5,7-triethylundecane |
| SMILES | CCCCC(CC)CC(CC)C(CC)CCC |
| InChI | InChI=1S/C17H36/c1-6-11-13-15(8-3)14-17(10-5)16(9-4)12-7-2/h15-17H,6-14H2,1-5H3 |
| InChIKey | YCLXJLDGQDYGQT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.47 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |