About 1-bromo-4-ethyl-5,8-dimethylnonane
1-bromo-4-ethyl-5,8-dimethylnonane (PubChem CID 89010236) has the molecular formula C13H27Br
and a molecular weight of 263.26 g/mol. Its IUPAC name is 1-bromo-4-ethyl-5,8-dimethylnonane.
Molecular Properties
| Compound Name | 1-bromo-4-ethyl-5,8-dimethylnonane |
| PubChem CID | 89010236 |
| Molecular Formula | C13H27Br |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-bromo-4-ethyl-5,8-dimethylnonane |
| SMILES | CCC(CCCBr)C(C)CCC(C)C |
| InChI | InChI=1S/C13H27Br/c1-5-13(7-6-10-14)12(4)9-8-11(2)3/h11-13H,5-10H2,1-4H3 |
| InChIKey | JOJCVUPSBUVZDD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-ethyl-5,8-dimethylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-ethyl-5,8-dimethylnonane?
The IUPAC name of 1-bromo-4-ethyl-5,8-dimethylnonane (CID 89010236) is 1-bromo-4-ethyl-5,8-dimethylnonane.
What is the SMILES notation for 1-bromo-4-ethyl-5,8-dimethylnonane?
The canonical SMILES for 1-bromo-4-ethyl-5,8-dimethylnonane is CCC(CCCBr)C(C)CCC(C)C.
What is the InChIKey of 1-bromo-4-ethyl-5,8-dimethylnonane?
The InChIKey is JOJCVUPSBUVZDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27Br/c1-5-13(7-6-10-14)12(4)9-8-11(2)3/h11-13H,5-10H2,1-4H3.
What are the key properties of 1-bromo-4-ethyl-5,8-dimethylnonane?
1-bromo-4-ethyl-5,8-dimethylnonane has a molecular weight of 263.26 g/mol, XLogP of 5.26, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-ethyl-5,8-dimethylnonane is sourced from PubChem (CID 89010236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).