About 3-propylheptan-1-ol
3-propylheptan-1-ol (PubChem CID 22492543) has the molecular formula C10H22O
and a molecular weight of 158.28 g/mol. Its IUPAC name is 3-propylheptan-1-ol.
Molecular Properties
| Compound Name | 3-propylheptan-1-ol |
| PubChem CID | 22492543 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | 3-propylheptan-1-ol |
| SMILES | CCCCC(CCC)CCO |
| InChI | InChI=1S/C10H22O/c1-3-5-7-10(6-4-2)8-9-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | UYZVDMGEEIRMSK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-propylheptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propylheptan-1-ol?
The IUPAC name of 3-propylheptan-1-ol (CID 22492543) is 3-propylheptan-1-ol.
What is the SMILES notation for 3-propylheptan-1-ol?
The canonical SMILES for 3-propylheptan-1-ol is CCCCC(CCC)CCO.
What is the InChIKey of 3-propylheptan-1-ol?
The InChIKey is UYZVDMGEEIRMSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O/c1-3-5-7-10(6-4-2)8-9-11/h10-11H,3-9H2,1-2H3.
What are the key properties of 3-propylheptan-1-ol?
3-propylheptan-1-ol has a molecular weight of 158.28 g/mol, XLogP of 2.98, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propylheptan-1-ol is sourced from PubChem (CID 22492543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).