C14H13ClN2O3 — CID 78800618
6-chloro-N-[2-(3,4-dihydroxyphenyl)ethyl]pyridine-3-carboxamide (PubChem CID 78800618) has the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. Its IUPAC name is 6-chloro-N-[2-(3,4-dihydroxyphenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[2-(3,4-dihydroxyphenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 78800618 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 6-chloro-N-[2-(3,4-dihydroxyphenyl)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ccc(O)c(O)c1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H13ClN2O3/c15-13-4-2-10(8-17-13)14(20)16-6-5-9-1-3-11(18)12(19)7-9/h1-4,7-8,18-19H,5-6H2,(H,16,20) |
| InChIKey | ZSVSWJSHPBETJU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|