C17H17ClN2O4 — CID 78796639
3-chloro-N-[2-[2-(3,4-dihydroxyphenyl)ethylamino]-2-oxoethyl]benzamide (PubChem CID 78796639) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is 3-chloro-N-[2-[2-(3,4-dihydroxyphenyl)ethylamino]-2-oxoethyl]benzamide.
| Compound Name | 3-chloro-N-[2-[2-(3,4-dihydroxyphenyl)ethylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 78796639 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 3-chloro-N-[2-[2-(3,4-dihydroxyphenyl)ethylamino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Cl)c1)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H17ClN2O4/c18-13-3-1-2-12(9-13)17(24)20-10-16(23)19-7-6-11-4-5-14(21)15(22)8-11/h1-5,8-9,21-22H,6-7,10H2,(H,19,23)(H,20,24) |
| InChIKey | KWFDMCSLFMUMRH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|