C15H24IN3O5S — CID 111671267
1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide (PubChem CID 111671267) has the molecular formula C15H24IN3O5S and a molecular weight of 485.34 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111671267 |
| Molecular Formula | C15H24IN3O5S |
| Molecular Weight | 485.34 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOCCS(C)(=O)=O)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C15H23N3O5S.HI/c1-16-15(17-5-6-21-7-8-24(2,19)20)18-10-12-3-4-13-14(9-12)23-11-22-13;/h3-4,9H,5-8,10-11H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | JCFYMVPPHXXNCZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|