C20H25FIN3O2 — CID 111846164
1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(2-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide (PubChem CID 111846164) has the molecular formula C20H25FIN3O2 and a molecular weight of 485.34 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(2-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(2-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111846164 |
| Molecular Formula | C20H25FIN3O2 |
| Molecular Weight | 485.34 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(2-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc2c(c1)OCO2)NCC(C)(C)c1ccccc1F.I |
| InChI | InChI=1S/C20H24FN3O2.HI/c1-20(2,15-6-4-5-7-16(15)21)12-24-19(22-3)23-11-14-8-9-17-18(10-14)26-13-25-17;/h4-10H,11-13H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | NINUAERHTIWCBO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|