C21H31F2IN6O — CID 111308989
1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methylguanidine;hydroiodide (PubChem CID 111308989) has the molecular formula C21H31F2IN6O and a molecular weight of 548.42 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111308989 |
| Molecular Formula | C21H31F2IN6O |
| Molecular Weight | 548.42 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nccn1C(F)F)NCC(c1ccc(OC)cc1)N1CCCCC1.I |
| InChI | InChI=1S/C21H30F2N6O.HI/c1-24-21(27-15-19-25-10-13-29(19)20(22)23)26-14-18(28-11-4-3-5-12-28)16-6-8-17(30-2)9-7-16;/h6-10,13,18,20H,3-5,11-12,14-15H2,1-2H3,(H2,24,26,27);1H |
| InChIKey | YVXGBQUCFGKIEU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|