C20H32IN7O — CID 111291674
1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide (PubChem CID 111291674) has the molecular formula C20H32IN7O and a molecular weight of 513.43 g/mol. Its IUPAC name is 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111291674 |
| Molecular Formula | C20H32IN7O |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCn1cnnc1CN/C(=N\C)NCC(c1ccc(OC)cc1)N1CCCC1.I |
| InChI | InChI=1S/C20H31N7O.HI/c1-4-26-15-24-25-19(26)14-23-20(21-2)22-13-18(27-11-5-6-12-27)16-7-9-17(28-3)10-8-16;/h7-10,15,18H,4-6,11-14H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | UDOAQBVDNBUSQV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|