C15H20FN5O — CID 111680912
1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine (PubChem CID 111680912) has the molecular formula C15H20FN5O and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine.
| Compound Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111680912 |
| Molecular Formula | C15H20FN5O |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccn[nH]1)NCC(C)Oc1cccc(F)c1 |
| InChI | InChI=1S/C15H20FN5O/c1-11(22-14-5-3-4-12(16)8-14)9-18-15(17-2)19-10-13-6-7-20-21-13/h3-8,11H,9-10H2,1-2H3,(H,20,21)(H2,17,18,19) |
| InChIKey | YMEUZNTZTQJNDE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|