C15H25FIN3O2 — CID 111682003
1-(2-ethoxyethyl)-3-[2-(3-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111682003) has the molecular formula C15H25FIN3O2 and a molecular weight of 425.29 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-[2-(3-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-ethoxyethyl)-3-[2-(3-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111682003 |
| Molecular Formula | C15H25FIN3O2 |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-[2-(3-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOCCN/C(=N\C)NCC(C)Oc1cccc(F)c1.I |
| InChI | InChI=1S/C15H24FN3O2.HI/c1-4-20-9-8-18-15(17-3)19-11-12(2)21-14-7-5-6-13(16)10-14;/h5-7,10,12H,4,8-9,11H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | UDOYIDFVDRVREC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|