C14H22FN3O3S — CID 111681420
1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine (PubChem CID 111681420) has the molecular formula C14H22FN3O3S and a molecular weight of 331.41 g/mol. Its IUPAC name is 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine.
| Compound Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111681420 |
| Molecular Formula | C14H22FN3O3S |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine |
| SMILES | C/N=C(\NCCS(C)(=O)=O)NCC(C)Oc1cccc(F)c1 |
| InChI | InChI=1S/C14H22FN3O3S/c1-11(21-13-6-4-5-12(15)9-13)10-18-14(16-2)17-7-8-22(3,19)20/h4-6,9,11H,7-8,10H2,1-3H3,(H2,16,17,18) |
| InChIKey | PVFHSIWFRPGSNN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|