C19H35IN4O3 — CID 111594073
ethyl 7-[[N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]heptanoate;hydroiodide (PubChem CID 111594073) has the molecular formula C19H35IN4O3 and a molecular weight of 494.42 g/mol. Its IUPAC name is ethyl 7-[[N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]heptanoate;hydroiodide.
| Compound Name | ethyl 7-[[N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 111594073 |
| Molecular Formula | C19H35IN4O3 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | ethyl 7-[[N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]heptanoate;hydroiodide |
| SMILES | CCOC(=O)CCCCCCN/C(=N\C)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C19H34N4O3.HI/c1-6-25-17(24)11-9-7-8-10-12-21-18(20-5)23-14-16-22-13-15(26-16)19(2,3)4;/h13H,6-12,14H2,1-5H3,(H2,20,21,23);1H |
| InChIKey | AUOXNNFZIOEXOF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|