C23H34FN7O — CID 111950843
1-ethyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 111950843) has the molecular formula C23H34FN7O and a molecular weight of 443.57 g/mol. Its IUPAC name is 1-ethyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111950843 |
| Molecular Formula | C23H34FN7O |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 1-ethyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(C)c1C)NCCC(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H34FN7O/c1-5-25-23(27-16-21-17(2)28-29(4)18(21)3)26-11-10-22(32)31-14-12-30(13-15-31)20-8-6-19(24)7-9-20/h6-9H,5,10-16H2,1-4H3,(H2,25,26,27) |
| InChIKey | ZNHGGOFYLBIIBF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 77.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|