C21H37N5O4 — CID 111672894
tert-butyl 4-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]piperazine-1-carboxylate (PubChem CID 111672894) has the molecular formula C21H37N5O4 and a molecular weight of 423.56 g/mol. Its IUPAC name is tert-butyl 4-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111672894 |
| Molecular Formula | C21H37N5O4 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | tert-butyl 4-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H37N5O4/c1-6-22-18(24-16-21(5,28)17-8-7-15-29-17)23-9-10-25-11-13-26(14-12-25)19(27)30-20(2,3)4/h7-8,15,28H,6,9-14,16H2,1-5H3,(H2,22,23,24) |
| InChIKey | NHEUUVHTQUZYAR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|