C11H23N5O3 — CID 67643209
tert-butyl 4-[2-(hydrazinecarbonyl)hydrazinyl]piperidine-1-carboxylate (PubChem CID 67643209) has the molecular formula C11H23N5O3 and a molecular weight of 273.34 g/mol. Its IUPAC name is tert-butyl 4-[2-(hydrazinecarbonyl)hydrazinyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(hydrazinecarbonyl)hydrazinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67643209 |
| Molecular Formula | C11H23N5O3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | tert-butyl 4-[2-(hydrazinecarbonyl)hydrazinyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NNC(=O)NN)CC1 |
| InChI | InChI=1S/C11H23N5O3/c1-11(2,3)19-10(18)16-6-4-8(5-7-16)14-15-9(17)13-12/h8,14H,4-7,12H2,1-3H3,(H2,13,15,17) |
| InChIKey | WLNTZJWTWNXKBH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|