C19H35NO4 — CID 142873744
methylcyclohexane;2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid (PubChem CID 142873744) has the molecular formula C19H35NO4 and a molecular weight of 341.49 g/mol. Its IUPAC name is methylcyclohexane;2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid.
| Compound Name | methylcyclohexane;2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 142873744 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | methylcyclohexane;2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC(=O)O)CC1.CC1CCCCC1 |
| InChI | InChI=1S/C12H21NO4.C7H14/c1-12(2,3)17-11(16)13-6-4-9(5-7-13)8-10(14)15;1-7-5-3-2-4-6-7/h9H,4-8H2,1-3H3,(H,14,15);7H,2-6H2,1H3 |
| InChIKey | HLCNNDBLUDGJNL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |