C17H34N2O3 — CID 145162230
tert-butyl 3-(2-ethylbutanoylamino)pyrrolidine-1-carboxylate;ethane (PubChem CID 145162230) has the molecular formula C17H34N2O3 and a molecular weight of 314.47 g/mol. Its IUPAC name is tert-butyl 3-(2-ethylbutanoylamino)pyrrolidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-(2-ethylbutanoylamino)pyrrolidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 145162230 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | tert-butyl 3-(2-ethylbutanoylamino)pyrrolidine-1-carboxylate;ethane |
| SMILES | CC.CCC(CC)C(=O)NC1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H28N2O3.C2H6/c1-6-11(7-2)13(18)16-12-8-9-17(10-12)14(19)20-15(3,4)5;1-2/h11-12H,6-10H2,1-5H3,(H,16,18);1-2H3 |
| InChIKey | SCPJFMNMDZWGHK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |