C11H22N4O2 — CID 167022048
tert-butyl (3R)-3-[(N'-methylcarbamimidoyl)amino]pyrrolidine-1-carboxylate (PubChem CID 167022048) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(N'-methylcarbamimidoyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(N'-methylcarbamimidoyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 167022048 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | tert-butyl (3R)-3-[(N'-methylcarbamimidoyl)amino]pyrrolidine-1-carboxylate |
| SMILES | C/N=C(\N)N[C@@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H22N4O2/c1-11(2,3)17-10(16)15-6-5-8(7-15)14-9(12)13-4/h8H,5-7H2,1-4H3,(H3,12,13,14)/t8-/m1/s1 |
| InChIKey | DRGAMZZMXQEZBK-MRVPVSSYSA-N |
| XLogP | 0.53 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|