C20H35N7O6S — CID 59660897
(2S)-2-[[(2S)-1-[(2R)-2-[[2-(butanoylamino)acetyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 59660897) has the molecular formula C20H35N7O6S and a molecular weight of 501.61 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-[(2R)-2-[[2-(butanoylamino)acetyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-[(2R)-2-[[2-(butanoylamino)acetyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 59660897 |
| Molecular Formula | C20H35N7O6S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | (2S)-2-[[(2S)-1-[(2R)-2-[[2-(butanoylamino)acetyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CCCC(=O)NCC(=O)N[C@@H](CS)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H35N7O6S/c1-2-5-15(28)24-10-16(29)25-13(11-34)18(31)27-9-4-7-14(27)17(30)26-12(19(32)33)6-3-8-23-20(21)22/h12-14,34H,2-11H2,1H3,(H,24,28)(H,25,29)(H,26,30)(H,32,33)(H4,21,22,23)/t12-,13-,14-/m0/s1 |
| InChIKey | FJPHUNJPAUOYKF-IHRRRGAJSA-N |
| XLogP | -2.07 |
| TPSA | 209.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|