C31H56Cl2N12O9 — CID 174387198
bis(chloromethyl (2S)-2-[[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoate);formaldehyde (PubChem CID 174387198) has the molecular formula C31H56Cl2N12O9 and a molecular weight of 811.77 g/mol. Its IUPAC name is bis(chloromethyl (2S)-2-[[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoate);formaldehyde.
| Compound Name | bis(chloromethyl (2S)-2-[[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoate);formaldehyde |
|---|---|
| PubChem CID | 174387198 |
| Molecular Formula | C31H56Cl2N12O9 |
| Molecular Weight | 811.77 g/mol |
| Exact Mass | 810.37 |
| IUPAC Name | bis(chloromethyl (2S)-2-[[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoate);formaldehyde |
| SMILES | C=O.C[C@H](N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)OCCl.C[C@H](N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)OCCl |
| InChI | InChI=1S/2C15H27ClN6O4.CH2O/c2*1-9(17)13(24)22-7-3-5-11(22)12(23)21-10(14(25)26-8-16)4-2-6-20-15(18)19;1-2/h2*9-11H,2-8,17H2,1H3,(H,21,23)(H4,18,19,20);1H2/t2*9-,10-,11-;/m00./s1 |
| InChIKey | VVASKFBCEOBUPU-LBGGCWCGSA-N |
| XLogP | -2.98 |
| TPSA | 349.33 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.77 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|