C17H31N7O5 — CID 131726098
(2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]propanoic acid (PubChem CID 131726098) has the molecular formula C17H31N7O5 and a molecular weight of 413.48 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 131726098 |
| Molecular Formula | C17H31N7O5 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | (2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]propanoic acid |
| SMILES | C[C@H](N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C17H31N7O5/c1-9(18)13(25)23-11(5-3-7-21-17(19)20)15(27)24-8-4-6-12(24)14(26)22-10(2)16(28)29/h9-12H,3-8,18H2,1-2H3,(H,22,26)(H,23,25)(H,28,29)(H4,19,20,21)/t9-,10-,11-,12-/m0/s1 |
| InChIKey | HQEDGNSSXVHXMW-BJDJZHNGSA-N |
| XLogP | -2.55 |
| TPSA | 206.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|