C19H35N5O5 — CID 18306551
2-[[1-[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]acetic acid (PubChem CID 18306551) has the molecular formula C19H35N5O5 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-[[1-[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 18306551 |
| Molecular Formula | C19H35N5O5 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 2-[[1-[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]acetic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCCN)C(=O)N1CCCC1C(=O)NCC(=O)O |
| InChI | InChI=1S/C19H35N5O5/c1-12(2)10-14(23-17(27)13(21)6-3-4-8-20)19(29)24-9-5-7-15(24)18(28)22-11-16(25)26/h12-15H,3-11,20-21H2,1-2H3,(H,22,28)(H,23,27)(H,25,26) |
| InChIKey | QKPHLMPLMHJFES-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|