C22H40N6O6 — CID 18304901
1-[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18304901) has the molecular formula C22H40N6O6 and a molecular weight of 484.60 g/mol. Its IUPAC name is 1-[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18304901 |
| Molecular Formula | C22H40N6O6 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 1-[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)CC(NC(=O)C(CCC(N)=O)NC(=O)C(N)CCCCN)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C22H40N6O6/c1-13(2)12-16(21(32)28-11-5-7-17(28)22(33)34)27-20(31)15(8-9-18(25)29)26-19(30)14(24)6-3-4-10-23/h13-17H,3-12,23-24H2,1-2H3,(H2,25,29)(H,26,30)(H,27,31)(H,33,34) |
| InChIKey | WZQBURHMEOTGRI-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 210.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|