C16H26N4O7 — CID 18238137
2-[2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]pentanedioic acid (PubChem CID 18238137) has the molecular formula C16H26N4O7 and a molecular weight of 386.41 g/mol. Its IUPAC name is 2-[2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]pentanedioic acid.
| Compound Name | 2-[2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 18238137 |
| Molecular Formula | C16H26N4O7 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-[2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]pentanedioic acid |
| SMILES | CC(N)C(=O)N1CCCC1C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H26N4O7/c1-8(17)15(25)20-7-3-4-11(20)14(24)18-9(2)13(23)19-10(16(26)27)5-6-12(21)22/h8-11H,3-7,17H2,1-2H3,(H,18,24)(H,19,23)(H,21,22)(H,26,27) |
| InChIKey | VFVNITBFGZZHAH-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 179.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |