C21H28N2O3 — CID 11810430
3,3-dimethyl-1-[(2S)-2-(4-pyridin-3-ylpent-4-enoyl)pyrrolidin-1-yl]pentane-1,2-dione (PubChem CID 11810430) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(2S)-2-(4-pyridin-3-ylpent-4-enoyl)pyrrolidin-1-yl]pentane-1,2-dione.
| Compound Name | 3,3-dimethyl-1-[(2S)-2-(4-pyridin-3-ylpent-4-enoyl)pyrrolidin-1-yl]pentane-1,2-dione |
|---|---|
| PubChem CID | 11810430 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 3,3-dimethyl-1-[(2S)-2-(4-pyridin-3-ylpent-4-enoyl)pyrrolidin-1-yl]pentane-1,2-dione |
| SMILES | C=C(CCC(=O)[C@@H]1CCCN1C(=O)C(=O)C(C)(C)CC)c1cccnc1 |
| InChI | InChI=1S/C21H28N2O3/c1-5-21(3,4)19(25)20(26)23-13-7-9-17(23)18(24)11-10-15(2)16-8-6-12-22-14-16/h6,8,12,14,17H,2,5,7,9-11,13H2,1,3-4H3/t17-/m0/s1 |
| InChIKey | MMDKMNWLJPVHKE-KRWDZBQOSA-N |
| XLogP | 3.44 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|