C21H27N3O3S — CID 23532266
3,3-dimethyl-1-[2-[4-(2-pyridin-3-yloxyethyl)-1,3-thiazol-2-yl]pyrrolidin-1-yl]pentane-1,2-dione (PubChem CID 23532266) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 3,3-dimethyl-1-[2-[4-(2-pyridin-3-yloxyethyl)-1,3-thiazol-2-yl]pyrrolidin-1-yl]pentane-1,2-dione.
| Compound Name | 3,3-dimethyl-1-[2-[4-(2-pyridin-3-yloxyethyl)-1,3-thiazol-2-yl]pyrrolidin-1-yl]pentane-1,2-dione |
|---|---|
| PubChem CID | 23532266 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 3,3-dimethyl-1-[2-[4-(2-pyridin-3-yloxyethyl)-1,3-thiazol-2-yl]pyrrolidin-1-yl]pentane-1,2-dione |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1c1nc(CCOc2cccnc2)cs1 |
| InChI | InChI=1S/C21H27N3O3S/c1-4-21(2,3)18(25)20(26)24-11-6-8-17(24)19-23-15(14-28-19)9-12-27-16-7-5-10-22-13-16/h5,7,10,13-14,17H,4,6,8-9,11-12H2,1-3H3 |
| InChIKey | DIDAHBVAEJEZTN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|