C22H27N3O3S — CID 23532324
N-benzyl-2-[1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidin-2-yl]-1,3-thiazole-4-carboxamide (PubChem CID 23532324) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is N-benzyl-2-[1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidin-2-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-benzyl-2-[1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidin-2-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 23532324 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | N-benzyl-2-[1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidin-2-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1c1nc(C(=O)NCc2ccccc2)cs1 |
| InChI | InChI=1S/C22H27N3O3S/c1-4-22(2,3)18(26)21(28)25-12-8-11-17(25)20-24-16(14-29-20)19(27)23-13-15-9-6-5-7-10-15/h5-7,9-10,14,17H,4,8,11-13H2,1-3H3,(H,23,27) |
| InChIKey | RBKRUIBOOHIYAT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|