C20H25N3O3S — CID 23532268
3,3-dimethyl-1-[2-[4-(pyridin-3-yloxymethyl)-1,3-thiazol-2-yl]pyrrolidin-1-yl]pentane-1,2-dione (PubChem CID 23532268) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 3,3-dimethyl-1-[2-[4-(pyridin-3-yloxymethyl)-1,3-thiazol-2-yl]pyrrolidin-1-yl]pentane-1,2-dione.
| Compound Name | 3,3-dimethyl-1-[2-[4-(pyridin-3-yloxymethyl)-1,3-thiazol-2-yl]pyrrolidin-1-yl]pentane-1,2-dione |
|---|---|
| PubChem CID | 23532268 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 3,3-dimethyl-1-[2-[4-(pyridin-3-yloxymethyl)-1,3-thiazol-2-yl]pyrrolidin-1-yl]pentane-1,2-dione |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1c1nc(COc2cccnc2)cs1 |
| InChI | InChI=1S/C20H25N3O3S/c1-4-20(2,3)17(24)19(25)23-10-6-8-16(23)18-22-14(13-27-18)12-26-15-7-5-9-21-11-15/h5,7,9,11,13,16H,4,6,8,10,12H2,1-3H3 |
| InChIKey | JNKKVQZQMSZWEB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|