C18H28N4O3S — CID 42813439
[1-[2-(butylamino)-1,3-thiazole-4-carbonyl]piperidin-2-yl]-morpholin-4-ylmethanone (PubChem CID 42813439) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is [1-[2-(butylamino)-1,3-thiazole-4-carbonyl]piperidin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-[2-(butylamino)-1,3-thiazole-4-carbonyl]piperidin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 42813439 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | [1-[2-(butylamino)-1,3-thiazole-4-carbonyl]piperidin-2-yl]-morpholin-4-ylmethanone |
| SMILES | CCCCNc1nc(C(=O)N2CCCCC2C(=O)N2CCOCC2)cs1 |
| InChI | InChI=1S/C18H28N4O3S/c1-2-3-7-19-18-20-14(13-26-18)16(23)22-8-5-4-6-15(22)17(24)21-9-11-25-12-10-21/h13,15H,2-12H2,1H3,(H,19,20) |
| InChIKey | UGXBMIJGHCEZFA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|