C15H20N2O4 — CID 4089666
[1-(furan-3-carbonyl)piperidin-2-yl]-morpholin-4-ylmethanone (PubChem CID 4089666) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is [1-(furan-3-carbonyl)piperidin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-(furan-3-carbonyl)piperidin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 4089666 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | [1-(furan-3-carbonyl)piperidin-2-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1CCCCN1C(=O)c1ccoc1)N1CCOCC1 |
| InChI | InChI=1S/C15H20N2O4/c18-14(12-4-8-21-11-12)17-5-2-1-3-13(17)15(19)16-6-9-20-10-7-16/h4,8,11,13H,1-3,5-7,9-10H2 |
| InChIKey | OSXUHNAMNOKMES-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |