C14H17BrN2O4 — CID 60707747
[1-(5-bromofuran-2-carbonyl)pyrrolidin-2-yl]-morpholin-4-ylmethanone (PubChem CID 60707747) has the molecular formula C14H17BrN2O4 and a molecular weight of 357.20 g/mol. Its IUPAC name is [1-(5-bromofuran-2-carbonyl)pyrrolidin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-(5-bromofuran-2-carbonyl)pyrrolidin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 60707747 |
| Molecular Formula | C14H17BrN2O4 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | [1-(5-bromofuran-2-carbonyl)pyrrolidin-2-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1CCCN1C(=O)c1ccc(Br)o1)N1CCOCC1 |
| InChI | InChI=1S/C14H17BrN2O4/c15-12-4-3-11(21-12)14(19)17-5-1-2-10(17)13(18)16-6-8-20-9-7-16/h3-4,10H,1-2,5-9H2 |
| InChIKey | GMOKVOBBYANOSB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |