C14H18BrNO2 — CID 102726484
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-bromofuran-2-yl)methanone (PubChem CID 102726484) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-bromofuran-2-yl)methanone.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-bromofuran-2-yl)methanone |
|---|---|
| PubChem CID | 102726484 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-bromofuran-2-yl)methanone |
| SMILES | O=C(c1ccc(Br)o1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C14H18BrNO2/c15-13-8-7-12(18-13)14(17)16-9-3-5-10-4-1-2-6-11(10)16/h7-8,10-11H,1-6,9H2/t10-,11-/m1/s1 |
| InChIKey | BPPCTVDENMTQCX-GHMZBOCLSA-N |
| XLogP | 3.84 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |