C12H15BrN2O2 — CID 68604035
2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl-(5-bromofuran-2-yl)methanone (PubChem CID 68604035) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl-(5-bromofuran-2-yl)methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl-(5-bromofuran-2-yl)methanone |
|---|---|
| PubChem CID | 68604035 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl-(5-bromofuran-2-yl)methanone |
| SMILES | O=C(c1ccc(Br)o1)N1CCC2CCNCC21 |
| InChI | InChI=1S/C12H15BrN2O2/c13-11-2-1-10(17-11)12(16)15-6-4-8-3-5-14-7-9(8)15/h1-2,8-9,14H,3-7H2 |
| InChIKey | VHSXFUNREHZCPZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |