C17H20F2N2O3 — CID 95173055
[(2R)-1-(2,5-difluorobenzoyl)piperidin-2-yl]-morpholin-4-ylmethanone (PubChem CID 95173055) has the molecular formula C17H20F2N2O3 and a molecular weight of 338.35 g/mol. Its IUPAC name is [(2R)-1-(2,5-difluorobenzoyl)piperidin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [(2R)-1-(2,5-difluorobenzoyl)piperidin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 95173055 |
| Molecular Formula | C17H20F2N2O3 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [(2R)-1-(2,5-difluorobenzoyl)piperidin-2-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@H]1CCCCN1C(=O)c1cc(F)ccc1F)N1CCOCC1 |
| InChI | InChI=1S/C17H20F2N2O3/c18-12-4-5-14(19)13(11-12)16(22)21-6-2-1-3-15(21)17(23)20-7-9-24-10-8-20/h4-5,11,15H,1-3,6-10H2/t15-/m1/s1 |
| InChIKey | PIXVTOMZXOAFQI-OAHLLOKOSA-N |
| XLogP | 1.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |