C18H24N2O4S — CID 87148506
[2-(pentylamino)-1,3-thiazol-4-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 87148506) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is [2-(pentylamino)-1,3-thiazol-4-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [2-(pentylamino)-1,3-thiazol-4-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 87148506 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [2-(pentylamino)-1,3-thiazol-4-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | CCCCCNc1nc(C(=O)c2cc(OC)c(OC)c(OC)c2)cs1 |
| InChI | InChI=1S/C18H24N2O4S/c1-5-6-7-8-19-18-20-13(11-25-18)16(21)12-9-14(22-2)17(24-4)15(10-12)23-3/h9-11H,5-8H2,1-4H3,(H,19,20) |
| InChIKey | QYAXYNTWNVNWOW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|