C22H25N3O5S2 — CID 23442779
2,5-dimethoxy-N-[3-[[4-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide (PubChem CID 23442779) has the molecular formula C22H25N3O5S2 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[3-[[4-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[3-[[4-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23442779 |
| Molecular Formula | C22H25N3O5S2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2,5-dimethoxy-N-[3-[[4-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCCCNc2nc(C(=O)c3ccccc3C)cs2)c1 |
| InChI | InChI=1S/C22H25N3O5S2/c1-15-7-4-5-8-17(15)21(26)18-14-31-22(25-18)23-11-6-12-24-32(27,28)20-13-16(29-2)9-10-19(20)30-3/h4-5,7-10,13-14,24H,6,11-12H2,1-3H3,(H,23,25) |
| InChIKey | AFUWFLOUXOEKPA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|