C18H24N4O4 — CID 113038340
N-[6-(butylamino)pyridazin-3-yl]-3,4,5-trimethoxybenzamide (PubChem CID 113038340) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-[6-(butylamino)pyridazin-3-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[6-(butylamino)pyridazin-3-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 113038340 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-[6-(butylamino)pyridazin-3-yl]-3,4,5-trimethoxybenzamide |
| SMILES | CCCCNc1ccc(NC(=O)c2cc(OC)c(OC)c(OC)c2)nn1 |
| InChI | InChI=1S/C18H24N4O4/c1-5-6-9-19-15-7-8-16(22-21-15)20-18(23)12-10-13(24-2)17(26-4)14(11-12)25-3/h7-8,10-11H,5-6,9H2,1-4H3,(H,19,21)(H,20,22,23) |
| InChIKey | PLXDHDSMRDZXCN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|